C36H39NO10 — CID 73353357
[(1S,2S,5S,6R,7R,9S,10S,18R)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl benzoate (PubChem CID 73353357) has the molecular formula C36H39NO10 and a molecular weight of 645.71 g/mol. Its IUPAC name is [(1S,2S,5S,6R,7R,9S,10S,18R)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl benzoate.
| Compound Name | [(1S,2S,5S,6R,7R,9S,10S,18R)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 73353357 |
| Molecular Formula | C36H39NO10 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | [(1S,2S,5S,6R,7R,9S,10S,18R)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](C[C@H](OC(C)=O)[C@@]3(C)Oc4cc(-c5cccnc5)oc(=O)c4[C@H](O)[C@H]23)[C@]1(C)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H39NO10/c1-20(38)44-27-13-14-34(3)26(35(27,4)19-43-32(41)22-10-7-6-8-11-22)17-28(45-21(2)39)36(5)31(34)30(40)29-25(47-36)16-24(46-33(29)42)23-12-9-15-37-18-23/h6-12,15-16,18,26-28,30-31,40H,13-14,17,19H2,1-5H3/t26-,27+,28+,30+,31-,34+,35+,36-/m1/s1 |
| InChIKey | GKBIVOBKGQWSLW-HRSZXCBJSA-N |
| XLogP | 5.05 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|