C22H19Cl2NO4 — CID 73353360
(3aR,5aS,9bS)-3'-(2,6-dichlorophenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione (PubChem CID 73353360) has the molecular formula C22H19Cl2NO4 and a molecular weight of 432.30 g/mol. Its IUPAC name is (3aR,5aS,9bS)-3'-(2,6-dichlorophenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione.
| Compound Name | (3aR,5aS,9bS)-3'-(2,6-dichlorophenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione |
|---|---|
| PubChem CID | 73353360 |
| Molecular Formula | C22H19Cl2NO4 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | (3aR,5aS,9bS)-3'-(2,6-dichlorophenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)C4(CC(c5c(Cl)cccc5Cl)=NO4)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C22H19Cl2NO4/c1-11-16(26)7-9-21(2)8-6-12-19(18(11)21)28-20(27)22(12)10-15(25-29-22)17-13(23)4-3-5-14(17)24/h3-5,7,9,12,19H,6,8,10H2,1-2H3/t12-,19+,21+,22?/m1/s1 |
| InChIKey | YXEOFPQQIQETJL-KMHOPROKSA-N |
| XLogP | 4.65 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |