C30H48O3 — CID 73353495
(5R,9R,10R,13S,14S,17S)-17-[(Z,2S,4S)-4,7-dihydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 73353495) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is (5R,9R,10R,13S,14S,17S)-17-[(Z,2S,4S)-4,7-dihydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,9R,10R,13S,14S,17S)-17-[(Z,2S,4S)-4,7-dihydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 73353495 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (5R,9R,10R,13S,14S,17S)-17-[(Z,2S,4S)-4,7-dihydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C/C(=C/[C@@H](O)C[C@H](C)[C@@H]1CC[C@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)[C@H]3CC[C@@]12C)CO |
| InChI | InChI=1S/C30H48O3/c1-19(18-31)16-21(32)17-20(2)22-10-14-30(7)24-8-9-25-27(3,4)26(33)12-13-28(25,5)23(24)11-15-29(22,30)6/h8,16,20-23,25,31-32H,9-15,17-18H2,1-7H3/b19-16-/t20-,21+,22-,23-,25-,28+,29-,30+/m0/s1 |
| InChIKey | NICYEWKTZSBFFV-FLELFTEASA-N |
| XLogP | 6.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|