C26H25F3O4 — CID 73353587
(1S,5R,7Z,10R,13S)-13-methoxy-5-[4-[2-(trifluoromethyl)phenyl]phenyl]-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one (PubChem CID 73353587) has the molecular formula C26H25F3O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is (1S,5R,7Z,10R,13S)-13-methoxy-5-[4-[2-(trifluoromethyl)phenyl]phenyl]-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one.
| Compound Name | (1S,5R,7Z,10R,13S)-13-methoxy-5-[4-[2-(trifluoromethyl)phenyl]phenyl]-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one |
|---|---|
| PubChem CID | 73353587 |
| Molecular Formula | C26H25F3O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (1S,5R,7Z,10R,13S)-13-methoxy-5-[4-[2-(trifluoromethyl)phenyl]phenyl]-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one |
| SMILES | CO[C@H]1C=C[C@H]2C/C=C\C[C@H](c3ccc(-c4ccccc4C(F)(F)F)cc3)OC(=O)C[C@@H]1O2 |
| InChI | InChI=1S/C26H25F3O4/c1-31-23-15-14-19-6-2-5-9-22(33-25(30)16-24(23)32-19)18-12-10-17(11-13-18)20-7-3-4-8-21(20)26(27,28)29/h2-5,7-8,10-15,19,22-24H,6,9,16H2,1H3/b5-2-/t19-,22-,23+,24+/m1/s1 |
| InChIKey | TWYLNKQMHHFCIV-GIQLWTPPSA-N |
| XLogP | 6.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|