C31H26N6O3 — CID 73353595
benzyl 3-amino-4-[[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]benzoyl]amino]benzoate (PubChem CID 73353595) has the molecular formula C31H26N6O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is benzyl 3-amino-4-[[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]benzoyl]amino]benzoate.
| Compound Name | benzyl 3-amino-4-[[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 73353595 |
| Molecular Formula | C31H26N6O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | benzyl 3-amino-4-[[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]benzoyl]amino]benzoate |
| SMILES | Nc1cc(C(=O)OCc2ccccc2)ccc1NC(=O)c1ccc(CNc2nccc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C31H26N6O3/c32-26-17-24(30(39)40-20-22-5-2-1-3-6-22)12-13-28(26)36-29(38)23-10-8-21(9-11-23)18-35-31-34-16-14-27(37-31)25-7-4-15-33-19-25/h1-17,19H,18,20,32H2,(H,36,38)(H,34,35,37) |
| InChIKey | APYLFXUAZAGFCK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|