C21H21BF2N2O2 — CID 73353679
methyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate (PubChem CID 73353679) has the molecular formula C21H21BF2N2O2 and a molecular weight of 382.22 g/mol. Its IUPAC name is methyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate.
| Compound Name | methyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate |
|---|---|
| PubChem CID | 73353679 |
| Molecular Formula | C21H21BF2N2O2 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | methyl 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2=C3C(C)=CC(C)=[N+]3[B-](F)(F)n3c(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C21H21BF2N2O2/c1-12-10-14(3)25-19(12)18(16-6-8-17(9-7-16)21(27)28-5)20-13(2)11-15(4)26(20)22(25,23)24/h6-11H,1-5H3 |
| InChIKey | GUYUSFKVEHWMBK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|