C15H24O3 — CID 73353713
(4Z,6S,9R,9aS)-9a-hydroperoxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-6-ol (PubChem CID 73353713) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (4Z,6S,9R,9aS)-9a-hydroperoxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-6-ol.
| Compound Name | (4Z,6S,9R,9aS)-9a-hydroperoxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-6-ol |
|---|---|
| PubChem CID | 73353713 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (4Z,6S,9R,9aS)-9a-hydroperoxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-6-ol |
| SMILES | C/C1=C/C2=CC(C)(C)C[C@]2(OO)[C@H](C)CC[C@@H]1O |
| InChI | InChI=1S/C15H24O3/c1-10-7-12-8-14(3,4)9-15(12,18-17)11(2)5-6-13(10)16/h7-8,11,13,16-17H,5-6,9H2,1-4H3/b10-7-/t11-,13+,15+/m1/s1 |
| InChIKey | JXXGQPLNOPZHMH-GUSBQHCYSA-N |
| XLogP | 3.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|