About N-(3-hydroxypropyl)-2,2,2-triphenylacetamide
N-(3-hydroxypropyl)-2,2,2-triphenylacetamide (PubChem CID 73353733) has the molecular formula C23H23NO2
and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,2,2-triphenylacetamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-2,2,2-triphenylacetamide |
| PubChem CID | 73353733 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(3-hydroxypropyl)-2,2,2-triphenylacetamide |
| SMILES | O=C(NCCCO)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c25-18-10-17-24-22(26)23(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-9,11-16,25H,10,17-18H2,(H,24,26) |
| InChIKey | UBZGLDNBDXUACZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-2,2,2-triphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-2,2,2-triphenylacetamide?
The IUPAC name of N-(3-hydroxypropyl)-2,2,2-triphenylacetamide (CID 73353733) is N-(3-hydroxypropyl)-2,2,2-triphenylacetamide.
What is the SMILES notation for N-(3-hydroxypropyl)-2,2,2-triphenylacetamide?
The canonical SMILES for N-(3-hydroxypropyl)-2,2,2-triphenylacetamide is O=C(NCCCO)C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(3-hydroxypropyl)-2,2,2-triphenylacetamide?
The InChIKey is UBZGLDNBDXUACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO2/c25-18-10-17-24-22(26)23(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-9,11-16,25H,10,17-18H2,(H,24,26).
What are the key properties of N-(3-hydroxypropyl)-2,2,2-triphenylacetamide?
N-(3-hydroxypropyl)-2,2,2-triphenylacetamide has a molecular weight of 345.44 g/mol, XLogP of 3.52, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-2,2,2-triphenylacetamide is sourced from PubChem (CID 73353733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).