C22H26F2N4O — CID 73353757
(2R,3S,5R)-5-(2-cyclopropyl-7,7-dimethyl-5H-pyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 73353757) has the molecular formula C22H26F2N4O and a molecular weight of 400.47 g/mol. Its IUPAC name is (2R,3S,5R)-5-(2-cyclopropyl-7,7-dimethyl-5H-pyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-(2-cyclopropyl-7,7-dimethyl-5H-pyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 73353757 |
| Molecular Formula | C22H26F2N4O |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (2R,3S,5R)-5-(2-cyclopropyl-7,7-dimethyl-5H-pyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | CC1(C)c2nc(C3CC3)ncc2CN1[C@H]1CO[C@H](c2cc(F)ccc2F)[C@@H](N)C1 |
| InChI | InChI=1S/C22H26F2N4O/c1-22(2)20-13(9-26-21(27-20)12-3-4-12)10-28(22)15-8-18(25)19(29-11-15)16-7-14(23)5-6-17(16)24/h5-7,9,12,15,18-19H,3-4,8,10-11,25H2,1-2H3/t15-,18+,19-/m1/s1 |
| InChIKey | ZCITVLSDPCXRRL-AYOQOUSVSA-N |
| XLogP | 3.54 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |