C28H38O8 — CID 73353787
[(4bS,8aS,9S,10S)-10-acetyloxy-4b,8,8-trimethyl-1,4-dioxo-3-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] propanoate (PubChem CID 73353787) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [(4bS,8aS,9S,10S)-10-acetyloxy-4b,8,8-trimethyl-1,4-dioxo-3-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] propanoate.
| Compound Name | [(4bS,8aS,9S,10S)-10-acetyloxy-4b,8,8-trimethyl-1,4-dioxo-3-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] propanoate |
|---|---|
| PubChem CID | 73353787 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [(4bS,8aS,9S,10S)-10-acetyloxy-4b,8,8-trimethyl-1,4-dioxo-3-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] propanoate |
| SMILES | CCC(=O)OC1=C(C(C)C)C(=O)C2=C(C1=O)[C@@]1(C)CCCC(C)(C)[C@@H]1[C@H](OC(=O)CC)[C@H]2OC(C)=O |
| InChI | InChI=1S/C28H38O8/c1-9-16(30)35-23-18(14(3)4)21(32)19-20(22(23)33)28(8)13-11-12-27(6,7)26(28)25(36-17(31)10-2)24(19)34-15(5)29/h14,24-26H,9-13H2,1-8H3/t24-,25+,26-,28+/m0/s1 |
| InChIKey | UVZISRISGACPKM-WLBXEJSFSA-N |
| XLogP | 4.40 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|