C20H23N3O — CID 73353905
trans-(1R,2R)-N-[(E)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 73353905) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(E)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[(E)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 73353905 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | trans-(1R,2R)-N-[(E)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@@H]1C[C@H]1c1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H23N3O/c1-14(15-9-11-17(12-10-15)23(2)3)21-22-20(24)19-13-18(19)16-7-5-4-6-8-16/h4-12,18-19H,13H2,1-3H3,(H,22,24)/b21-14+/t18-,19+/m0/s1 |
| InChIKey | KMWAHLOZZBVMDN-JKMYOGEHSA-N |
| XLogP | 3.40 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|