About 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate
2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate (PubChem CID 7335397) has the molecular formula C23H19N2O3-
and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate |
| PubChem CID | 7335397 |
| Molecular Formula | C23H19N2O3- |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate |
| SMILES | Cn1c(=O)n(C)c2cc(C(C(=O)[O-])(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C23H20N2O3/c1-24-19-14-13-18(15-20(19)25(2)22(24)28)23(21(26)27,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15H,1-2H3,(H,26,27)/p-1 |
| InChIKey | MVEDIRFBALHPNP-UHFFFAOYSA-M |
| XLogP | 1.96 |
| TPSA | 67.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate?
The IUPAC name of 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate (CID 7335397) is 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate.
What is the SMILES notation for 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate?
The canonical SMILES for 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate is Cn1c(=O)n(C)c2cc(C(C(=O)[O-])(c3ccccc3)c3ccccc3)ccc21.
What is the InChIKey of 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate?
The InChIKey is MVEDIRFBALHPNP-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H20N2O3/c1-24-19-14-13-18(15-20(19)25(2)22(24)28)23(21(26)27,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15H,1-2H3,(H,26,27)/p-1.
What are the key properties of 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate?
2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate has a molecular weight of 371.42 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,2-diphenylacetate is sourced from PubChem (CID 7335397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).