C15H16FN3O2S — CID 73354002
ethyl 2-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 73354002) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 73354002 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl 2-[(2E)-2-[1-(4-fluorophenyl)ethylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N/N=C(\C)c2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C15H16FN3O2S/c1-4-21-14(20)13-10(3)17-15(22-13)19-18-9(2)11-5-7-12(16)8-6-11/h5-8H,4H2,1-3H3,(H,17,19)/b18-9+ |
| InChIKey | PCHGOUYNSVFNRU-GIJQJNRQSA-N |
| XLogP | 3.60 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|