About 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane
2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane (PubChem CID 73354150) has the molecular formula C13H10O
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane.
Molecular Properties
| Compound Name | 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane |
| PubChem CID | 73354150 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane |
| SMILES | C=CC1OC1/C=C/C#CC#CC#CC |
| InChI | InChI=1S/C13H10O/c1-3-5-6-7-8-9-10-11-13-12(4-2)14-13/h4,10-13H,2H2,1H3/b11-10+ |
| InChIKey | ZJMXHGIVVFPAJY-ZHACJKMWSA-N |
| XLogP | 1.53 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane?
The IUPAC name of 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane (CID 73354150) is 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane.
What is the SMILES notation for 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane?
The canonical SMILES for 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane is C=CC1OC1/C=C/C#CC#CC#CC.
What is the InChIKey of 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane?
The InChIKey is ZJMXHGIVVFPAJY-ZHACJKMWSA-N. The full InChI is InChI=1S/C13H10O/c1-3-5-6-7-8-9-10-11-13-12(4-2)14-13/h4,10-13H,2H2,1H3/b11-10+.
What are the key properties of 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane?
2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane has a molecular weight of 182.22 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane is sourced from PubChem (CID 73354150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).