C26H21N5O2 — CID 73354355
(3S)-1-(2-nitrophenyl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 73354355) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is (3S)-1-(2-nitrophenyl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (3S)-1-(2-nitrophenyl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 73354355 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (3S)-1-(2-nitrophenyl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | O=[N+]([O-])c1ccccc1C1N[C@H](c2ncc(-c3ccccc3)[nH]2)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C26H21N5O2/c32-31(33)23-13-7-5-11-18(23)24-25-19(17-10-4-6-12-20(17)28-25)14-21(29-24)26-27-15-22(30-26)16-8-2-1-3-9-16/h1-13,15,21,24,28-29H,14H2,(H,27,30)/t21-,24?/m0/s1 |
| InChIKey | ZDLSKZKPNCDHHD-XEGCMXMBSA-N |
| XLogP | 5.44 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|