C33H38O9 — CID 73354397
(1S,2R,4S,6'R,9R)-9-hydroxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone (PubChem CID 73354397) has the molecular formula C33H38O9 and a molecular weight of 578.66 g/mol. Its IUPAC name is (1S,2R,4S,6'R,9R)-9-hydroxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone.
| Compound Name | (1S,2R,4S,6'R,9R)-9-hydroxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone |
|---|---|
| PubChem CID | 73354397 |
| Molecular Formula | C33H38O9 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | (1S,2R,4S,6'R,9R)-9-hydroxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone |
| SMILES | CC(C)=CC[C@@H]1C(=O)C2=C(OC(C)(C)C=C2)C(=O)[C@@]12OC(=O)C1=C[C@]3(O)C[C@H]4C(C)(C)OC(CC=C(C)C)(C3=O)[C@]14O2 |
| InChI | InChI=1S/C33H38O9/c1-17(2)9-10-20-23(34)19-12-13-28(5,6)39-24(19)25(35)33(20)40-26(36)21-15-30(38)16-22-29(7,8)41-31(27(30)37,14-11-18(3)4)32(21,22)42-33/h9,11-13,15,20,22,38H,10,14,16H2,1-8H3/t20-,22+,30+,31?,32+,33-/m1/s1 |
| InChIKey | DZXPHWBIDWFQQH-DVOQWBBESA-N |
| XLogP | 3.90 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|