C32H46N6O8 — CID 73354737
acetic acid;(2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide (PubChem CID 73354737) has the molecular formula C32H46N6O8 and a molecular weight of 642.75 g/mol. Its IUPAC name is acetic acid;(2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide.
| Compound Name | acetic acid;(2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 73354737 |
| Molecular Formula | C32H46N6O8 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | acetic acid;(2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
| SMILES | CC(=O)O.CC[C@@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C30H42N6O6.C2H4O2/c1-4-23(35-28(40)22(31)15-20-10-12-21(37)13-11-20)29(41)33-17-26(38)34-25(16-19-8-6-5-7-9-19)30(42)36-24(27(32)39)14-18(2)3;1-2(3)4/h5-13,18,22-25,37H,4,14-17,31H2,1-3H3,(H2,32,39)(H,33,41)(H,34,38)(H,35,40)(H,36,42);1H3,(H,3,4)/t22-,23+,24-,25-;/m0./s1 |
| InChIKey | IFHVUYVHQNPMQV-DKVOZMMNSA-N |
| XLogP | 0.11 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |