C20H38N8O5 — CID 73354766
tert-butyl N-[(2R)-5-(1-aminoethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 73354766) has the molecular formula C20H38N8O5 and a molecular weight of 470.58 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-(1-aminoethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-(1-aminoethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 73354766 |
| Molecular Formula | C20H38N8O5 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | tert-butyl N-[(2R)-5-(1-aminoethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | C/C(N)=N\CCC[C@@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C20H38N8O5/c1-13(21)24-9-6-8-15(28-19(32)33-20(2,3)4)17(31)26-11-16(30)27-14(12-29)7-5-10-25-18(22)23/h12,14-15H,5-11H2,1-4H3,(H2,21,24)(H,26,31)(H,27,30)(H,28,32)(H4,22,23,25)/t14-,15+/m0/s1 |
| InChIKey | CXZCTGBJWCGRRI-LSDHHAIUSA-N |
| XLogP | -1.11 |
| TPSA | 216.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|