C13H11N5S2 — CID 73354871
N,3-dimethyl-11-(1,3-thiazol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 73354871) has the molecular formula C13H11N5S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is N,3-dimethyl-11-(1,3-thiazol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | N,3-dimethyl-11-(1,3-thiazol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 73354871 |
| Molecular Formula | C13H11N5S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N,3-dimethyl-11-(1,3-thiazol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | CNc1nc2cc(-c3nccs3)sc2c2c1ncn2C |
| InChI | InChI=1S/C13H11N5S2/c1-14-12-9-10(18(2)6-16-9)11-7(17-12)5-8(20-11)13-15-3-4-19-13/h3-6H,1-2H3,(H,14,17) |
| InChIKey | PBPPBCBOUZYZAG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |