C30H25NO4 — CID 73354876
(3aR,5aS,9bS)-3'-anthracen-9-yl-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione (PubChem CID 73354876) has the molecular formula C30H25NO4 and a molecular weight of 463.53 g/mol. Its IUPAC name is (3aR,5aS,9bS)-3'-anthracen-9-yl-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione.
| Compound Name | (3aR,5aS,9bS)-3'-anthracen-9-yl-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione |
|---|---|
| PubChem CID | 73354876 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (3aR,5aS,9bS)-3'-anthracen-9-yl-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)C4(CC(c5c6ccccc6cc6ccccc56)=NO4)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C30H25NO4/c1-17-24(32)12-14-29(2)13-11-22-27(26(17)29)34-28(33)30(22)16-23(31-35-30)25-20-9-5-3-7-18(20)15-19-8-4-6-10-21(19)25/h3-10,12,14-15,22,27H,11,13,16H2,1-2H3/t22-,27+,29+,30?/m1/s1 |
| InChIKey | KMXLDTJBZQRQKK-DNEIWOHTSA-N |
| XLogP | 5.65 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|