About 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide
4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide (PubChem CID 73354900) has the molecular formula C16H14N4O3S2
and a molecular weight of 374.45 g/mol. Its IUPAC name is 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| PubChem CID | 73354900 |
| Molecular Formula | C16H14N4O3S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| SMILES | Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)sc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14N4O3S2/c17-15-14(13(21)10-4-2-1-3-5-10)24-16(20-15)19-11-6-8-12(9-7-11)25(18,22)23/h1-9H,17H2,(H,19,20)(H2,18,22,23) |
| InChIKey | SIHPQWGESUQLJI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
The IUPAC name of 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide (CID 73354900) is 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide.
What is the SMILES notation for 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
The canonical SMILES for 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide is Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)sc1C(=O)c1ccccc1.
What is the InChIKey of 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
The InChIKey is SIHPQWGESUQLJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O3S2/c17-15-14(13(21)10-4-2-1-3-5-10)24-16(20-15)19-11-6-8-12(9-7-11)25(18,22)23/h1-9H,17H2,(H,19,20)(H2,18,22,23).
What are the key properties of 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide has a molecular weight of 374.45 g/mol, XLogP of 2.35, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)amino]benzenesulfonamide is sourced from PubChem (CID 73354900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).