C15H28O3 — CID 73354957
(6R)-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]heptane-2,3,6-triol (PubChem CID 73354957) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (6R)-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]heptane-2,3,6-triol.
| Compound Name | (6R)-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]heptane-2,3,6-triol |
|---|---|
| PubChem CID | 73354957 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (6R)-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]heptane-2,3,6-triol |
| SMILES | CC1=CC[C@H]([C@](C)(O)CCC(O)C(C)(C)O)CC1 |
| InChI | InChI=1S/C15H28O3/c1-11-5-7-12(8-6-11)15(4,18)10-9-13(16)14(2,3)17/h5,12-13,16-18H,6-10H2,1-4H3/t12-,13?,15+/m0/s1 |
| InChIKey | VJRDDDSFQNYGBK-RMTCENKZSA-N |
| XLogP | 2.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|