C33H47N5O4 — CID 73355166
(2R)-N-[(2S)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide (PubChem CID 73355166) has the molecular formula C33H47N5O4 and a molecular weight of 577.77 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide.
| Compound Name | (2R)-N-[(2S)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 73355166 |
| Molecular Formula | C33H47N5O4 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.36 |
| IUPAC Name | (2R)-N-[(2S)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
| SMILES | CCCC[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(N)=O |
| InChI | InChI=1S/C33H47N5O4/c1-2-3-19-27(32(41)37-28(30(35)39)21-24-15-9-5-10-16-24)36-33(42)29(22-25-17-11-6-12-18-25)38-31(40)26(34)20-23-13-7-4-8-14-23/h4,6-8,11-14,17-18,24,26-29H,2-3,5,9-10,15-16,19-22,34H2,1H3,(H2,35,39)(H,36,42)(H,37,41)(H,38,40)/t26-,27+,28-,29-/m0/s1 |
| InChIKey | GCCLPURMYVYMCP-CRNKYVSFSA-N |
| XLogP | 2.90 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |