C41H35N3O3 — CID 73355332
4,10-diphenyl-2-[4-(4-phenylpiperazin-1-yl)butyl]indeno[1,2-f]isoindole-1,3,9-trione (PubChem CID 73355332) has the molecular formula C41H35N3O3 and a molecular weight of 617.75 g/mol. Its IUPAC name is 4,10-diphenyl-2-[4-(4-phenylpiperazin-1-yl)butyl]indeno[1,2-f]isoindole-1,3,9-trione.
| Compound Name | 4,10-diphenyl-2-[4-(4-phenylpiperazin-1-yl)butyl]indeno[1,2-f]isoindole-1,3,9-trione |
|---|---|
| PubChem CID | 73355332 |
| Molecular Formula | C41H35N3O3 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 4,10-diphenyl-2-[4-(4-phenylpiperazin-1-yl)butyl]indeno[1,2-f]isoindole-1,3,9-trione |
| SMILES | O=c1c2ccccc2c2c(-c3ccccc3)c3c(=O)n(CCCCN4CCN(c5ccccc5)CC4)c(=O)c3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C41H35N3O3/c45-39-32-21-11-10-20-31(32)35-33(28-14-4-1-5-15-28)37-38(34(36(35)39)29-16-6-2-7-17-29)41(47)44(40(37)46)23-13-12-22-42-24-26-43(27-25-42)30-18-8-3-9-19-30/h1-11,14-21H,12-13,22-27H2 |
| InChIKey | HJVQULBMLWUABJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|