About 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine
5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine (PubChem CID 73355555) has the molecular formula C11H11N3O3
and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine |
| PubChem CID | 73355555 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine |
| SMILES | Cc1cc(NCc2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C11H11N3O3/c1-8-6-11(13-17-8)12-7-9-2-4-10(5-3-9)14(15)16/h2-6H,7H2,1H3,(H,12,13) |
| InChIKey | RACDKZBOOBXQJU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine?
The IUPAC name of 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine (CID 73355555) is 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine.
What is the SMILES notation for 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine?
The canonical SMILES for 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine is Cc1cc(NCc2ccc([N+](=O)[O-])cc2)no1.
What is the InChIKey of 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine?
The InChIKey is RACDKZBOOBXQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3/c1-8-6-11(13-17-8)12-7-9-2-4-10(5-3-9)14(15)16/h2-6H,7H2,1H3,(H,12,13).
What are the key properties of 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine?
5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine has a molecular weight of 233.23 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(4-nitrophenyl)methyl]-1,2-oxazol-3-amine is sourced from PubChem (CID 73355555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).