About 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide
4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide (PubChem CID 73355561) has the molecular formula C14H20N4O2S
and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide |
| PubChem CID | 73355561 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide |
| SMILES | CCCCc1c(C)nn(-c2ccncc2S(N)(=O)=O)c1C |
| InChI | InChI=1S/C14H20N4O2S/c1-4-5-6-12-10(2)17-18(11(12)3)13-7-8-16-9-14(13)21(15,19)20/h7-9H,4-6H2,1-3H3,(H2,15,19,20) |
| InChIKey | CKSYHALTDNVTKG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide?
The IUPAC name of 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide (CID 73355561) is 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide.
What is the SMILES notation for 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide?
The canonical SMILES for 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide is CCCCc1c(C)nn(-c2ccncc2S(N)(=O)=O)c1C.
What is the InChIKey of 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide?
The InChIKey is CKSYHALTDNVTKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2S/c1-4-5-6-12-10(2)17-18(11(12)3)13-7-8-16-9-14(13)21(15,19)20/h7-9H,4-6H2,1-3H3,(H2,15,19,20).
What are the key properties of 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide?
4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide has a molecular weight of 308.41 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-butyl-3,5-dimethylpyrazol-1-yl)pyridine-3-sulfonamide is sourced from PubChem (CID 73355561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).