C21H27N5O — CID 7335558
N-[(1R)-1-(1-adamantyl)ethyl]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 7335558) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 7335558 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | C[C@@H](NC(=O)Cn1nnc(-c2ccccc2)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27N5O/c1-14(21-10-15-7-16(11-21)9-17(8-15)12-21)22-19(27)13-26-24-20(23-25-26)18-5-3-2-4-6-18/h2-6,14-17H,7-13H2,1H3,(H,22,27)/t14-,15?,16?,17?,21?/m1/s1 |
| InChIKey | ZUFZPCBUTKRXHY-LFPRZYRFSA-N |
| XLogP | 3.06 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |