C35H30O13S3 — CID 73355673
25,26,27,28-tetrahydroxy-23-(4-methylphenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid (PubChem CID 73355673) has the molecular formula C35H30O13S3 and a molecular weight of 754.81 g/mol. Its IUPAC name is 25,26,27,28-tetrahydroxy-23-(4-methylphenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid.
| Compound Name | 25,26,27,28-tetrahydroxy-23-(4-methylphenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
|---|---|
| PubChem CID | 73355673 |
| Molecular Formula | C35H30O13S3 |
| Molecular Weight | 754.81 g/mol |
| Exact Mass | 754.08 |
| IUPAC Name | 25,26,27,28-tetrahydroxy-23-(4-methylphenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
| SMILES | Cc1ccc(-c2cc3c(O)c(c2)Cc2cc(S(=O)(=O)O)cc(c2O)Cc2cc(S(=O)(=O)O)cc(c2O)Cc2cc(S(=O)(=O)O)cc(c2O)C3)cc1 |
| InChI | InChI=1S/C35H30O13S3/c1-18-2-4-19(5-3-18)20-6-21-8-23-12-29(49(40,41)42)14-25(33(23)37)10-27-16-31(51(46,47)48)17-28(35(27)39)11-26-15-30(50(43,44)45)13-24(34(26)38)9-22(7-20)32(21)36/h2-7,12-17,36-39H,8-11H2,1H3,(H,40,41,42)(H,43,44,45)(H,46,47,48) |
| InChIKey | QHFLAPBAXWBZDU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 244.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.81 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|