C23H20N4O2S — CID 73355724
N-[2-imidazol-1-yl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-4-phenylthiophene-2-carboxamide (PubChem CID 73355724) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is N-[2-imidazol-1-yl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[2-imidazol-1-yl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 73355724 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[2-imidazol-1-yl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-4-phenylthiophene-2-carboxamide |
| SMILES | CO/N=C(\C)c1ccc(-n2ccnc2)c(NC(=O)c2cc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C23H20N4O2S/c1-16(26-29-2)18-8-9-21(27-11-10-24-15-27)20(12-18)25-23(28)22-13-19(14-30-22)17-6-4-3-5-7-17/h3-15H,1-2H3,(H,25,28)/b26-16+ |
| InChIKey | MRIBKYPLCHHHKJ-WGOQTCKBSA-N |
| XLogP | 5.22 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|