C24H32N2O7 — CID 73355802
benzyl (2S)-1-[(2S)-2-[[(2R,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate (PubChem CID 73355802) has the molecular formula C24H32N2O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-2-[[(2R,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-2-[[(2R,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 73355802 |
| Molecular Formula | C24H32N2O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | benzyl (2S)-1-[(2S)-2-[[(2R,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H32N2O7/c1-4-31-24(30)20-19(33-20)21(27)25-17(13-15(2)3)22(28)26-12-8-11-18(26)23(29)32-14-16-9-6-5-7-10-16/h5-7,9-10,15,17-20H,4,8,11-14H2,1-3H3,(H,25,27)/t17-,18-,19+,20-/m0/s1 |
| InChIKey | GQLQTLGJYTXSQX-HAGHYFMRSA-N |
| XLogP | 1.58 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|