C17H15N — CID 73355963
(1R,9S)-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene (PubChem CID 73355963) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is (1R,9S)-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene.
| Compound Name | (1R,9S)-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene |
|---|---|
| PubChem CID | 73355963 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (1R,9S)-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene |
| SMILES | C[C@@]12Cc3ccccc3[C@@H](C=N1)c1ccccc12 |
| InChI | InChI=1S/C17H15N/c1-17-10-12-6-2-3-7-13(12)15(11-18-17)14-8-4-5-9-16(14)17/h2-9,11,15H,10H2,1H3/t15-,17+/m1/s1 |
| InChIKey | MZHFRMGXHVOIHQ-WBVHZDCISA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |