C17H21N5O6 — CID 73356387
[(4S,6R,7R,8S)-11-amino-7-methoxy-12-methyl-5-(methylcarbamoyl)-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-8-yl]methyl carbamate (PubChem CID 73356387) has the molecular formula C17H21N5O6 and a molecular weight of 391.38 g/mol. Its IUPAC name is [(4S,6R,7R,8S)-11-amino-7-methoxy-12-methyl-5-(methylcarbamoyl)-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-8-yl]methyl carbamate.
| Compound Name | [(4S,6R,7R,8S)-11-amino-7-methoxy-12-methyl-5-(methylcarbamoyl)-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-8-yl]methyl carbamate |
|---|---|
| PubChem CID | 73356387 |
| Molecular Formula | C17H21N5O6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [(4S,6R,7R,8S)-11-amino-7-methoxy-12-methyl-5-(methylcarbamoyl)-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-8-yl]methyl carbamate |
| SMILES | CNC(=O)N1[C@H]2CN3C4=C(C(=O)C(N)=C(C)C4=O)[C@@H](COC(N)=O)[C@@]3(OC)[C@@H]21 |
| InChI | InChI=1S/C17H21N5O6/c1-6-10(18)13(24)9-7(5-28-15(19)25)17(27-3)14-8(22(14)16(26)20-2)4-21(17)11(9)12(6)23/h7-8,14H,4-5,18H2,1-3H3,(H2,19,25)(H,20,26)/t7-,8+,14-,17-,22?/m1/s1 |
| InChIKey | NYGMKVWEVKNEKQ-FTBDQATQSA-N |
| XLogP | -1.60 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|