C23H23NO5 — CID 73356432
(3aR,5aS,9bS)-3'-(4-methoxyphenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione (PubChem CID 73356432) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is (3aR,5aS,9bS)-3'-(4-methoxyphenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione.
| Compound Name | (3aR,5aS,9bS)-3'-(4-methoxyphenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione |
|---|---|
| PubChem CID | 73356432 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (3aR,5aS,9bS)-3'-(4-methoxyphenyl)-5a,9-dimethylspiro[3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-3,5'-4H-1,2-oxazole]-2,8-dione |
| SMILES | COc1ccc(C2=NOC3(C2)C(=O)O[C@@H]2C4=C(C)C(=O)C=C[C@]4(C)CC[C@H]23)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-13-18(25)9-11-22(2)10-8-16-20(19(13)22)28-21(26)23(16)12-17(24-29-23)14-4-6-15(27-3)7-5-14/h4-7,9,11,16,20H,8,10,12H2,1-3H3/t16-,20+,22+,23?/m1/s1 |
| InChIKey | OCFYALVTQHAIBC-VSWXYFIDSA-N |
| XLogP | 3.36 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |