C26H38O7 — CID 73356506
[(3S,5R,8S,9S,10S,12S,13S,14S,17S)-3,12-diacetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl acetate (PubChem CID 73356506) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is [(3S,5R,8S,9S,10S,12S,13S,14S,17S)-3,12-diacetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl acetate.
| Compound Name | [(3S,5R,8S,9S,10S,12S,13S,14S,17S)-3,12-diacetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl acetate |
|---|---|
| PubChem CID | 73356506 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(3S,5R,8S,9S,10S,12S,13S,14S,17S)-3,12-diacetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3C(=O)[C@@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C26H38O7/c1-14(27)31-13-18-7-9-21-20-8-6-17-12-19(32-15(2)28)10-11-25(17,4)22(20)23(30)24(26(18,21)5)33-16(3)29/h17-22,24H,6-13H2,1-5H3/t17-,18-,19+,20+,21+,22-,24-,25+,26-/m1/s1 |
| InChIKey | QXWKXJDVSDLUPT-BJDORAKJSA-N |
| XLogP | 3.86 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|