C19H21BrO4 — CID 73356657
(1S,5R,7Z,10R,13S)-5-(4-bromophenyl)-13-methoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one (PubChem CID 73356657) has the molecular formula C19H21BrO4 and a molecular weight of 393.28 g/mol. Its IUPAC name is (1S,5R,7Z,10R,13S)-5-(4-bromophenyl)-13-methoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one.
| Compound Name | (1S,5R,7Z,10R,13S)-5-(4-bromophenyl)-13-methoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one |
|---|---|
| PubChem CID | 73356657 |
| Molecular Formula | C19H21BrO4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | (1S,5R,7Z,10R,13S)-5-(4-bromophenyl)-13-methoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one |
| SMILES | CO[C@H]1C=C[C@H]2C/C=C\C[C@H](c3ccc(Br)cc3)OC(=O)C[C@@H]1O2 |
| InChI | InChI=1S/C19H21BrO4/c1-22-17-11-10-15-4-2-3-5-16(13-6-8-14(20)9-7-13)24-19(21)12-18(17)23-15/h2-3,6-11,15-18H,4-5,12H2,1H3/b3-2-/t15-,16-,17+,18+/m1/s1 |
| InChIKey | UZBRBCKVYBARLH-VIKMZUAJSA-N |
| XLogP | 4.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|