C29H32F2N2O2 — CID 73356672
N-[(2S,3R)-4-[[(1S)-7-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 73356672) has the molecular formula C29H32F2N2O2 and a molecular weight of 478.58 g/mol. Its IUPAC name is N-[(2S,3R)-4-[[(1S)-7-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-4-[[(1S)-7-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 73356672 |
| Molecular Formula | C29H32F2N2O2 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[(2S,3R)-4-[[(1S)-7-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@H]1CCCc2ccc(Cc3ccccc3)cc21 |
| InChI | InChI=1S/C29H32F2N2O2/c1-19(34)33-28(16-22-13-24(30)17-25(31)14-22)29(35)18-32-27-9-5-8-23-11-10-21(15-26(23)27)12-20-6-3-2-4-7-20/h2-4,6-7,10-11,13-15,17,27-29,32,35H,5,8-9,12,16,18H2,1H3,(H,33,34)/t27-,28-,29+/m0/s1 |
| InChIKey | SJRWKADIBQLHDB-YTCPBCGMSA-N |
| XLogP | 4.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |