About propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate
propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate (PubChem CID 73356724) has the molecular formula C24H22O5
and a molecular weight of 390.44 g/mol. Its IUPAC name is propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate.
Molecular Properties
| Compound Name | propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate |
| PubChem CID | 73356724 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate |
| SMILES | CCCOC(=O)c1cccc(-c2ccc(C3COC4(C=CC(=O)C=C4)O3)cc2)c1 |
| InChI | InChI=1S/C24H22O5/c1-2-14-27-23(26)20-5-3-4-19(15-20)17-6-8-18(9-7-17)22-16-28-24(29-22)12-10-21(25)11-13-24/h3-13,15,22H,2,14,16H2,1H3 |
| InChIKey | RVQKYRJXWCBVJI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate?
The IUPAC name of propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate (CID 73356724) is propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate.
What is the SMILES notation for propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate?
The canonical SMILES for propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate is CCCOC(=O)c1cccc(-c2ccc(C3COC4(C=CC(=O)C=C4)O3)cc2)c1.
What is the InChIKey of propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate?
The InChIKey is RVQKYRJXWCBVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O5/c1-2-14-27-23(26)20-5-3-4-19(15-20)17-6-8-18(9-7-17)22-16-28-24(29-22)12-10-21(25)11-13-24/h3-13,15,22H,2,14,16H2,1H3.
What are the key properties of propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate?
propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate has a molecular weight of 390.44 g/mol, XLogP of 4.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-[4-(8-oxo-1,4-dioxaspiro[4.5]deca-6,9-dien-3-yl)phenyl]benzoate is sourced from PubChem (CID 73356724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).