C17H17BF2N2S — CID 73356740
2,2-difluoro-4,6,10,12-tetramethyl-8-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 73356740) has the molecular formula C17H17BF2N2S and a molecular weight of 330.21 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 73356740 |
| Molecular Formula | C17H17BF2N2S |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1cccs1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C17H17BF2N2S/c1-10-8-12(3)21-16(10)15(14-6-5-7-23-14)17-11(2)9-13(4)22(17)18(21,19)20/h5-9H,1-4H3 |
| InChIKey | WDRNQLYDRWGPMN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|