About 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol
3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol (PubChem CID 733568) has the molecular formula C18H13N3OS
and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol.
Molecular Properties
| Compound Name | 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol |
| PubChem CID | 733568 |
| Molecular Formula | C18H13N3OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol |
| SMILES | Oc1cccc(Nc2ncnc3sc(-c4ccccc4)cc23)c1 |
| InChI | InChI=1S/C18H13N3OS/c22-14-8-4-7-13(9-14)21-17-15-10-16(12-5-2-1-3-6-12)23-18(15)20-11-19-17/h1-11,22H,(H,19,20,21) |
| InChIKey | ARHDHZPSUWKYQE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol?
The IUPAC name of 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol (CID 733568) is 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol.
What is the SMILES notation for 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol?
The canonical SMILES for 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol is Oc1cccc(Nc2ncnc3sc(-c4ccccc4)cc23)c1.
What is the InChIKey of 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol?
The InChIKey is ARHDHZPSUWKYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3OS/c22-14-8-4-7-13(9-14)21-17-15-10-16(12-5-2-1-3-6-12)23-18(15)20-11-19-17/h1-11,22H,(H,19,20,21).
What are the key properties of 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol?
3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol has a molecular weight of 319.39 g/mol, XLogP of 4.81, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol is sourced from PubChem (CID 733568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).