C17H21FO3 — CID 73356908
(2S,4aR,8R,8aR)-2-(4-fluorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol (PubChem CID 73356908) has the molecular formula C17H21FO3 and a molecular weight of 292.35 g/mol. Its IUPAC name is (2S,4aR,8R,8aR)-2-(4-fluorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol.
| Compound Name | (2S,4aR,8R,8aR)-2-(4-fluorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol |
|---|---|
| PubChem CID | 73356908 |
| Molecular Formula | C17H21FO3 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2S,4aR,8R,8aR)-2-(4-fluorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol |
| SMILES | CC1=CC[C@@H]2[C@@H](O[C@H](c3ccc(F)cc3)OC2(C)C)[C@@H]1O |
| InChI | InChI=1S/C17H21FO3/c1-10-4-9-13-15(14(10)19)20-16(21-17(13,2)3)11-5-7-12(18)8-6-11/h4-8,13-16,19H,9H2,1-3H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | YJRQZUHDLTUHHJ-FPCVCCKLSA-N |
| XLogP | 3.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|