C18H18ClN — CID 73356927
(1S,3aR,9bS)-6-chloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole (PubChem CID 73356927) has the molecular formula C18H18ClN and a molecular weight of 283.80 g/mol. Its IUPAC name is (1S,3aR,9bS)-6-chloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole.
| Compound Name | (1S,3aR,9bS)-6-chloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole |
|---|---|
| PubChem CID | 73356927 |
| Molecular Formula | C18H18ClN |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (1S,3aR,9bS)-6-chloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole |
| SMILES | Clc1cccc2c1CC[C@H]1NC[C@H](c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C18H18ClN/c19-16-8-4-7-14-13(16)9-10-17-18(14)15(11-20-17)12-5-2-1-3-6-12/h1-8,15,17-18,20H,9-11H2/t15-,17-,18-/m1/s1 |
| InChIKey | NCPFSSICYASJEG-KBAYOESNSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |