About (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol
(E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol (PubChem CID 73357069) has the molecular formula C18H20ClFN2O2
and a molecular weight of 350.82 g/mol. Its IUPAC name is (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol |
| PubChem CID | 73357069 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol |
| SMILES | CC1CN(c2cc(/C=C/CO)nc3cc(F)c(Cl)cc23)CC(C)O1 |
| InChI | InChI=1S/C18H20ClFN2O2/c1-11-9-22(10-12(2)24-11)18-6-13(4-3-5-23)21-17-8-16(20)15(19)7-14(17)18/h3-4,6-8,11-12,23H,5,9-10H2,1-2H3/b4-3+ |
| InChIKey | YWRPHXMRUYEACS-ONEGZZNKSA-N |
| XLogP | 3.65 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol?
The IUPAC name of (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol (CID 73357069) is (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol.
What is the SMILES notation for (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol?
The canonical SMILES for (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol is CC1CN(c2cc(/C=C/CO)nc3cc(F)c(Cl)cc23)CC(C)O1.
What is the InChIKey of (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol?
The InChIKey is YWRPHXMRUYEACS-ONEGZZNKSA-N. The full InChI is InChI=1S/C18H20ClFN2O2/c1-11-9-22(10-12(2)24-11)18-6-13(4-3-5-23)21-17-8-16(20)15(19)7-14(17)18/h3-4,6-8,11-12,23H,5,9-10H2,1-2H3/b4-3+.
What are the key properties of (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol?
(E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol has a molecular weight of 350.82 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[6-chloro-4-(2,6-dimethylmorpholin-4-yl)-7-fluoroquinolin-2-yl]prop-2-en-1-ol is sourced from PubChem (CID 73357069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).