C7H13NO5 — CID 73357394
(3R,5R)-6-amino-1,3,5-trihydroxy-5-methylhexane-2,4-dione (PubChem CID 73357394) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is (3R,5R)-6-amino-1,3,5-trihydroxy-5-methylhexane-2,4-dione.
| Compound Name | (3R,5R)-6-amino-1,3,5-trihydroxy-5-methylhexane-2,4-dione |
|---|---|
| PubChem CID | 73357394 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (3R,5R)-6-amino-1,3,5-trihydroxy-5-methylhexane-2,4-dione |
| SMILES | C[C@@](O)(CN)C(=O)[C@H](O)C(=O)CO |
| InChI | InChI=1S/C7H13NO5/c1-7(13,3-8)6(12)5(11)4(10)2-9/h5,9,11,13H,2-3,8H2,1H3/t5-,7-/m1/s1 |
| InChIKey | AAOORZHVZSVKQN-IYSWYEEDSA-N |
| XLogP | -2.81 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|