3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid

C11H16N2O2 — CID 73357530

IUPAC3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid
SMILESCC(C)c1n[nH]c2c1C(C(=O)O)CCC2
InChIInChI=1S/C11H16N2O2/c1-6(2)10-9-7(11(14)15)4-3-5-8(9)12-13-10/h6-7H,3-5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeyGMCYTGDBHLUXEL-UHFFFAOYSA-N
MW208.26 g/mol
LogP2.04
Rot. Bonds2

About 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid

3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid (PubChem CID 73357530) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid.

Molecular Properties

Compound Name3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid
PubChem CID73357530
Molecular FormulaC11H16N2O2
Molecular Weight208.26 g/mol
Exact Mass208.12
IUPAC Name3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid
SMILESCC(C)c1n[nH]c2c1C(C(=O)O)CCC2
InChIInChI=1S/C11H16N2O2/c1-6(2)10-9-7(11(14)15)4-3-5-8(9)12-13-10/h6-7H,3-5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeyGMCYTGDBHLUXEL-UHFFFAOYSA-N
XLogP2.04
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid?
The IUPAC name of 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid (CID 73357530) is 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid.
What is the SMILES notation for 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid?
The canonical SMILES for 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid is CC(C)c1n[nH]c2c1C(C(=O)O)CCC2.
What is the InChIKey of 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid?
The InChIKey is GMCYTGDBHLUXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-6(2)10-9-7(11(14)15)4-3-5-8(9)12-13-10/h6-7H,3-5H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid?
3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid has a molecular weight of 208.26 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole-4-carboxylic acid is sourced from PubChem (CID 73357530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).