About 2,2-difluorocyclohexan-1-amine;methane
2,2-difluorocyclohexan-1-amine;methane (PubChem CID 73357625) has the molecular formula C7H15F2N
and a molecular weight of 151.20 g/mol. Its IUPAC name is 2,2-difluorocyclohexan-1-amine;methane.
Molecular Properties
| Compound Name | 2,2-difluorocyclohexan-1-amine;methane |
| PubChem CID | 73357625 |
| Molecular Formula | C7H15F2N |
| Molecular Weight | 151.20 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | 2,2-difluorocyclohexan-1-amine;methane |
| SMILES | C.NC1CCCCC1(F)F |
| InChI | InChI=1S/C6H11F2N.CH4/c7-6(8)4-2-1-3-5(6)9;/h5H,1-4,9H2;1H4 |
| InChIKey | PIZYXHWSXWKHEX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluorocyclohexan-1-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluorocyclohexan-1-amine;methane?
The IUPAC name of 2,2-difluorocyclohexan-1-amine;methane (CID 73357625) is 2,2-difluorocyclohexan-1-amine;methane.
What is the SMILES notation for 2,2-difluorocyclohexan-1-amine;methane?
The canonical SMILES for 2,2-difluorocyclohexan-1-amine;methane is C.NC1CCCCC1(F)F.
What is the InChIKey of 2,2-difluorocyclohexan-1-amine;methane?
The InChIKey is PIZYXHWSXWKHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2N.CH4/c7-6(8)4-2-1-3-5(6)9;/h5H,1-4,9H2;1H4.
What are the key properties of 2,2-difluorocyclohexan-1-amine;methane?
2,2-difluorocyclohexan-1-amine;methane has a molecular weight of 151.20 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluorocyclohexan-1-amine;methane is sourced from PubChem (CID 73357625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).