C14H26FeO16 — CID 73357735
bis((3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate);iron(2+) (PubChem CID 73357735) has the molecular formula C14H26FeO16 and a molecular weight of 506.19 g/mol. Its IUPAC name is bis((3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate);iron(2+).
| Compound Name | bis((3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate);iron(2+) |
|---|---|
| PubChem CID | 73357735 |
| Molecular Formula | C14H26FeO16 |
| Molecular Weight | 506.19 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | bis((3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate);iron(2+) |
| SMILES | O=C([O-])C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C([O-])C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Fe+2] |
| InChI | InChI=1S/2C7H14O8.Fe/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2-,3-,4+,5-,6?;/m11./s1 |
| InChIKey | HSPKORNFDDMCAR-KMRXSBRUSA-L |
| XLogP | -10.94 |
| TPSA | 323.02 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.19 |
| LogP ≤ 5 | -10.94 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|