About Ammonium hydrogen imidodisulphate
Ammonium hydrogen imidodisulphate (PubChem CID 73357750) has the molecular formula H6N2O6S2
and a molecular weight of 194.19 g/mol.
Molecular Properties
| Compound Name | Ammonium hydrogen imidodisulphate |
| PubChem CID | 73357750 |
| Molecular Formula | H6N2O6S2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | — |
| SMILES | [H+].[H]N=S(=O)([O-])OS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/H3NO6S2.H3N/c1-8(2,3)7-9(4,5)6;/h(H2,1,2,3)(H,4,5,6);1H3 |
| InChIKey | NOKBIBRWUQJWDM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 166.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze Ammonium hydrogen imidodisulphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ammonium hydrogen imidodisulphate?
The IUPAC name of Ammonium hydrogen imidodisulphate (CID 73357750) is not available.
What is the SMILES notation for Ammonium hydrogen imidodisulphate?
The canonical SMILES for Ammonium hydrogen imidodisulphate is [H+].[H]N=S(=O)([O-])OS(=O)(=O)[O-].[NH4+].
What is the InChIKey of Ammonium hydrogen imidodisulphate?
The InChIKey is NOKBIBRWUQJWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/H3NO6S2.H3N/c1-8(2,3)7-9(4,5)6;/h(H2,1,2,3)(H,4,5,6);1H3.
What are the key properties of Ammonium hydrogen imidodisulphate?
Ammonium hydrogen imidodisulphate has a molecular weight of 194.19 g/mol, XLogP of -0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Ammonium hydrogen imidodisulphate is sourced from PubChem (CID 73357750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).