About Imidodisulfuric acid
Imidodisulfuric acid (PubChem CID 73357751) has the molecular formula H3NO6S2
and a molecular weight of 177.16 g/mol.
Molecular Properties
| Compound Name | Imidodisulfuric acid |
| PubChem CID | 73357751 |
| Molecular Formula | H3NO6S2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 176.94 |
| IUPAC Name | — |
| SMILES | [H]N=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/H3NO6S2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H,4,5,6) |
| InChIKey | QFARLUFBHFUZOK-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze Imidodisulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Imidodisulfuric acid?
The IUPAC name of Imidodisulfuric acid (CID 73357751) is not available.
What is the SMILES notation for Imidodisulfuric acid?
The canonical SMILES for Imidodisulfuric acid is [H]N=S(=O)(O)OS(=O)(=O)O.
What is the InChIKey of Imidodisulfuric acid?
The InChIKey is QFARLUFBHFUZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/H3NO6S2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H,4,5,6).
What are the key properties of Imidodisulfuric acid?
Imidodisulfuric acid has a molecular weight of 177.16 g/mol, XLogP of -0.76, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Imidodisulfuric acid is sourced from PubChem (CID 73357751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).