C16H15NO4S — CID 73358142
ethyl 2,5-dioxo-7-thiophen-2-yl-3,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 73358142) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is ethyl 2,5-dioxo-7-thiophen-2-yl-3,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2,5-dioxo-7-thiophen-2-yl-3,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 73358142 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | ethyl 2,5-dioxo-7-thiophen-2-yl-3,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C=C2C(=O)CC(c3cccs3)CC2=NC1=O |
| InChI | InChI=1S/C16H15NO4S/c1-2-21-16(20)11-8-10-12(17-15(11)19)6-9(7-13(10)18)14-4-3-5-22-14/h3-5,8-9,11H,2,6-7H2,1H3 |
| InChIKey | PYXYNCWGVZFFHN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|