About [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate
[(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate (PubChem CID 7336055) has the molecular formula C19H31NO4
and a molecular weight of 337.46 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate.
Molecular Properties
| Compound Name | [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate |
| PubChem CID | 7336055 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)OC[C@@H](O)CN1CCOCC1 |
| InChI | InChI=1S/C19H31NO4/c21-17(12-20-1-3-23-4-2-20)13-24-18(22)11-19-8-14-5-15(9-19)7-16(6-14)10-19/h14-17,21H,1-13H2/t14?,15?,16?,17-,19?/m0/s1 |
| InChIKey | BMBIZCWGIXBYRA-WCWCZOKXSA-N |
| XLogP | 1.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate?
The IUPAC name of [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate (CID 7336055) is [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate.
What is the SMILES notation for [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate?
The canonical SMILES for [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate is O=C(CC12CC3CC(CC(C3)C1)C2)OC[C@@H](O)CN1CCOCC1.
What is the InChIKey of [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate?
The InChIKey is BMBIZCWGIXBYRA-WCWCZOKXSA-N. The full InChI is InChI=1S/C19H31NO4/c21-17(12-20-1-3-23-4-2-20)13-24-18(22)11-19-8-14-5-15(9-19)7-16(6-14)10-19/h14-17,21H,1-13H2/t14?,15?,16?,17-,19?/m0/s1.
What are the key properties of [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate?
[(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate has a molecular weight of 337.46 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-hydroxy-3-morpholin-4-ylpropyl] 2-(1-adamantyl)acetate is sourced from PubChem (CID 7336055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).